About (2S)-N,N-dimethylpyrrolidine-2-carboxamide;molecular hydrogen
(2S)-N,N-dimethylpyrrolidine-2-carboxamide;molecular hydrogen (PubChem CID 143692131) has the molecular formula C7H16N2O
and a molecular weight of 144.22 g/mol. Its IUPAC name is (2S)-N,N-dimethylpyrrolidine-2-carboxamide;molecular hydrogen.
Analyze (2S)-N,N-dimethylpyrrolidine-2-carboxamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N,N-dimethylpyrrolidine-2-carboxamide;molecular hydrogen?
The IUPAC name of (2S)-N,N-dimethylpyrrolidine-2-carboxamide;molecular hydrogen (CID 143692131) is (2S)-N,N-dimethylpyrrolidine-2-carboxamide;molecular hydrogen.
What is the SMILES notation for (2S)-N,N-dimethylpyrrolidine-2-carboxamide;molecular hydrogen?
The canonical SMILES for (2S)-N,N-dimethylpyrrolidine-2-carboxamide;molecular hydrogen is CN(C)C(=O)[C@@H]1CCCN1.[H][H].
What is the InChIKey of (2S)-N,N-dimethylpyrrolidine-2-carboxamide;molecular hydrogen?
The InChIKey is RULVPBSQAJWWMM-RGMNGODLSA-N. The full InChI is InChI=1S/C7H14N2O.H2/c1-9(2)7(10)6-4-3-5-8-6;/h6,8H,3-5H2,1-2H3;1H/t6-;/m0./s1.
What are the key properties of (2S)-N,N-dimethylpyrrolidine-2-carboxamide;molecular hydrogen?
(2S)-N,N-dimethylpyrrolidine-2-carboxamide;molecular hydrogen has a molecular weight of 144.22 g/mol, XLogP of 0.07, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N,N-dimethylpyrrolidine-2-carboxamide;molecular hydrogen is sourced from PubChem (CID 143692131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).