(2S)-N,N-dimethylpyrrolidine-2-carboxamide;molecular hydrogen

C7H16N2O — CID 143692131

IUPAC(2S)-N,N-dimethylpyrrolidine-2-carboxamide;molecular hydrogen
SMILESCN(C)C(=O)[C@@H]1CCCN1.[H][H]
InChIInChI=1S/C7H14N2O.H2/c1-9(2)7(10)6-4-3-5-8-6;/h6,8H,3-5H2,1-2H3;1H/t6-;/m0./s1
InChIKeyRULVPBSQAJWWMM-RGMNGODLSA-N
MW144.22 g/mol
LogP0.07
Rot. Bonds1

About (2S)-N,N-dimethylpyrrolidine-2-carboxamide;molecular hydrogen

(2S)-N,N-dimethylpyrrolidine-2-carboxamide;molecular hydrogen (PubChem CID 143692131) has the molecular formula C7H16N2O and a molecular weight of 144.22 g/mol. Its IUPAC name is (2S)-N,N-dimethylpyrrolidine-2-carboxamide;molecular hydrogen.

Molecular Properties

Compound Name(2S)-N,N-dimethylpyrrolidine-2-carboxamide;molecular hydrogen
PubChem CID143692131
Molecular FormulaC7H16N2O
Molecular Weight144.22 g/mol
Exact Mass144.13
IUPAC Name(2S)-N,N-dimethylpyrrolidine-2-carboxamide;molecular hydrogen
SMILESCN(C)C(=O)[C@@H]1CCCN1.[H][H]
InChIInChI=1S/C7H14N2O.H2/c1-9(2)7(10)6-4-3-5-8-6;/h6,8H,3-5H2,1-2H3;1H/t6-;/m0./s1
InChIKeyRULVPBSQAJWWMM-RGMNGODLSA-N
XLogP0.07
TPSA32.34 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500144.22
LogP ≤ 50.07
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze (2S)-N,N-dimethylpyrrolidine-2-carboxamide;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-N,N-dimethylpyrrolidine-2-carboxamide;molecular hydrogen?
The IUPAC name of (2S)-N,N-dimethylpyrrolidine-2-carboxamide;molecular hydrogen (CID 143692131) is (2S)-N,N-dimethylpyrrolidine-2-carboxamide;molecular hydrogen.
What is the SMILES notation for (2S)-N,N-dimethylpyrrolidine-2-carboxamide;molecular hydrogen?
The canonical SMILES for (2S)-N,N-dimethylpyrrolidine-2-carboxamide;molecular hydrogen is CN(C)C(=O)[C@@H]1CCCN1.[H][H].
What is the InChIKey of (2S)-N,N-dimethylpyrrolidine-2-carboxamide;molecular hydrogen?
The InChIKey is RULVPBSQAJWWMM-RGMNGODLSA-N. The full InChI is InChI=1S/C7H14N2O.H2/c1-9(2)7(10)6-4-3-5-8-6;/h6,8H,3-5H2,1-2H3;1H/t6-;/m0./s1.
What are the key properties of (2S)-N,N-dimethylpyrrolidine-2-carboxamide;molecular hydrogen?
(2S)-N,N-dimethylpyrrolidine-2-carboxamide;molecular hydrogen has a molecular weight of 144.22 g/mol, XLogP of 0.07, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N,N-dimethylpyrrolidine-2-carboxamide;molecular hydrogen is sourced from PubChem (CID 143692131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).