About 7-(1,3-dioxolan-2-yl)hept-4-ynyl acetate
7-(1,3-dioxolan-2-yl)hept-4-ynyl acetate (PubChem CID 11322103) has the molecular formula C12H18O4
and a molecular weight of 226.27 g/mol. Its IUPAC name is 7-(1,3-dioxolan-2-yl)hept-4-ynyl acetate.
Molecular Properties
| Compound Name | 7-(1,3-dioxolan-2-yl)hept-4-ynyl acetate |
| PubChem CID | 11322103 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 7-(1,3-dioxolan-2-yl)hept-4-ynyl acetate |
| SMILES | CC(=O)OCCCC#CCCC1OCCO1 |
| InChI | InChI=1S/C12H18O4/c1-11(13)14-8-6-4-2-3-5-7-12-15-9-10-16-12/h12H,4-10H2,1H3 |
| InChIKey | GKYQWCOCZQWMRX-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-(1,3-dioxolan-2-yl)hept-4-ynyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(1,3-dioxolan-2-yl)hept-4-ynyl acetate?
The IUPAC name of 7-(1,3-dioxolan-2-yl)hept-4-ynyl acetate (CID 11322103) is 7-(1,3-dioxolan-2-yl)hept-4-ynyl acetate.
What is the SMILES notation for 7-(1,3-dioxolan-2-yl)hept-4-ynyl acetate?
The canonical SMILES for 7-(1,3-dioxolan-2-yl)hept-4-ynyl acetate is CC(=O)OCCCC#CCCC1OCCO1.
What is the InChIKey of 7-(1,3-dioxolan-2-yl)hept-4-ynyl acetate?
The InChIKey is GKYQWCOCZQWMRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O4/c1-11(13)14-8-6-4-2-3-5-7-12-15-9-10-16-12/h12H,4-10H2,1H3.
What are the key properties of 7-(1,3-dioxolan-2-yl)hept-4-ynyl acetate?
7-(1,3-dioxolan-2-yl)hept-4-ynyl acetate has a molecular weight of 226.27 g/mol, XLogP of 1.49, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(1,3-dioxolan-2-yl)hept-4-ynyl acetate is sourced from PubChem (CID 11322103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).