About dodec-10-ynyl acetate
dodec-10-ynyl acetate (PubChem CID 13135130) has the molecular formula C14H24O2
and a molecular weight of 224.34 g/mol. Its IUPAC name is dodec-10-ynyl acetate.
Molecular Properties
| Compound Name | dodec-10-ynyl acetate |
| PubChem CID | 13135130 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | dodec-10-ynyl acetate |
| SMILES | CC#CCCCCCCCCCOC(C)=O |
| InChI | InChI=1S/C14H24O2/c1-3-4-5-6-7-8-9-10-11-12-13-16-14(2)15/h5-13H2,1-2H3 |
| InChIKey | DXXZYZCLMFQKGS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze dodec-10-ynyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodec-10-ynyl acetate?
The IUPAC name of dodec-10-ynyl acetate (CID 13135130) is dodec-10-ynyl acetate.
What is the SMILES notation for dodec-10-ynyl acetate?
The canonical SMILES for dodec-10-ynyl acetate is CC#CCCCCCCCCCOC(C)=O.
What is the InChIKey of dodec-10-ynyl acetate?
The InChIKey is DXXZYZCLMFQKGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O2/c1-3-4-5-6-7-8-9-10-11-12-13-16-14(2)15/h5-13H2,1-2H3.
What are the key properties of dodec-10-ynyl acetate?
dodec-10-ynyl acetate has a molecular weight of 224.34 g/mol, XLogP of 3.69, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dodec-10-ynyl acetate is sourced from PubChem (CID 13135130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).