About hept-5-ynyl 2-aminoacetate
hept-5-ynyl 2-aminoacetate (PubChem CID 118488806) has the molecular formula C9H15NO2
and a molecular weight of 169.22 g/mol. Its IUPAC name is hept-5-ynyl 2-aminoacetate.
Molecular Properties
| Compound Name | hept-5-ynyl 2-aminoacetate |
| PubChem CID | 118488806 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | hept-5-ynyl 2-aminoacetate |
| SMILES | CC#CCCCCOC(=O)CN |
| InChI | InChI=1S/C9H15NO2/c1-2-3-4-5-6-7-12-9(11)8-10/h4-8,10H2,1H3 |
| InChIKey | PHRDHTVQTCVSJG-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze hept-5-ynyl 2-aminoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hept-5-ynyl 2-aminoacetate?
The IUPAC name of hept-5-ynyl 2-aminoacetate (CID 118488806) is hept-5-ynyl 2-aminoacetate.
What is the SMILES notation for hept-5-ynyl 2-aminoacetate?
The canonical SMILES for hept-5-ynyl 2-aminoacetate is CC#CCCCCOC(=O)CN.
What is the InChIKey of hept-5-ynyl 2-aminoacetate?
The InChIKey is PHRDHTVQTCVSJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2/c1-2-3-4-5-6-7-12-9(11)8-10/h4-8,10H2,1H3.
What are the key properties of hept-5-ynyl 2-aminoacetate?
hept-5-ynyl 2-aminoacetate has a molecular weight of 169.22 g/mol, XLogP of 0.68, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hept-5-ynyl 2-aminoacetate is sourced from PubChem (CID 118488806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).