About dodec-10-en-8-ynyl acetate
dodec-10-en-8-ynyl acetate (PubChem CID 154077171) has the molecular formula C14H22O2
and a molecular weight of 222.33 g/mol. Its IUPAC name is dodec-10-en-8-ynyl acetate.
Molecular Properties
| Compound Name | dodec-10-en-8-ynyl acetate |
| PubChem CID | 154077171 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | dodec-10-en-8-ynyl acetate |
| SMILES | CC=CC#CCCCCCCCOC(C)=O |
| InChI | InChI=1S/C14H22O2/c1-3-4-5-6-7-8-9-10-11-12-13-16-14(2)15/h3-4H,7-13H2,1-2H3 |
| InChIKey | PQYHBJQSPQLANQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze dodec-10-en-8-ynyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodec-10-en-8-ynyl acetate?
The IUPAC name of dodec-10-en-8-ynyl acetate (CID 154077171) is dodec-10-en-8-ynyl acetate.
What is the SMILES notation for dodec-10-en-8-ynyl acetate?
The canonical SMILES for dodec-10-en-8-ynyl acetate is CC=CC#CCCCCCCCOC(C)=O.
What is the InChIKey of dodec-10-en-8-ynyl acetate?
The InChIKey is PQYHBJQSPQLANQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O2/c1-3-4-5-6-7-8-9-10-11-12-13-16-14(2)15/h3-4H,7-13H2,1-2H3.
What are the key properties of dodec-10-en-8-ynyl acetate?
dodec-10-en-8-ynyl acetate has a molecular weight of 222.33 g/mol, XLogP of 3.47, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dodec-10-en-8-ynyl acetate is sourced from PubChem (CID 154077171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).