C16H18O4 — CID 139252459
[(5E,7E)-12-acetyloxydodeca-5,7-dien-3,9-diynyl] acetate (PubChem CID 139252459) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is [(5E,7E)-12-acetyloxydodeca-5,7-dien-3,9-diynyl] acetate.
| Compound Name | [(5E,7E)-12-acetyloxydodeca-5,7-dien-3,9-diynyl] acetate |
|---|---|
| PubChem CID | 139252459 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | [(5E,7E)-12-acetyloxydodeca-5,7-dien-3,9-diynyl] acetate |
| SMILES | CC(=O)OCCC#C/C=C/C=C/C#CCCOC(C)=O |
| InChI | InChI=1S/C16H18O4/c1-15(17)19-13-11-9-7-5-3-4-6-8-10-12-14-20-16(2)18/h3-6H,11-14H2,1-2H3/b5-3+,6-4+ |
| InChIKey | XXBWHLLGJLRFGN-GGWOSOGESA-N |
| XLogP | 2.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|