C19H26O3 — CID 101424590
[(8E,10E,14S)-14-hydroxyheptadeca-8,10-dien-4,6-diynyl] acetate (PubChem CID 101424590) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is [(8E,10E,14S)-14-hydroxyheptadeca-8,10-dien-4,6-diynyl] acetate.
| Compound Name | [(8E,10E,14S)-14-hydroxyheptadeca-8,10-dien-4,6-diynyl] acetate |
|---|---|
| PubChem CID | 101424590 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | [(8E,10E,14S)-14-hydroxyheptadeca-8,10-dien-4,6-diynyl] acetate |
| SMILES | CCC[C@H](O)CC/C=C/C=C/C#CC#CCCCOC(C)=O |
| InChI | InChI=1S/C19H26O3/c1-3-15-19(21)16-13-11-9-7-5-4-6-8-10-12-14-17-22-18(2)20/h5,7,9,11,19,21H,3,12-17H2,1-2H3/b7-5+,11-9+/t19-/m0/s1 |
| InChIKey | FBEHFIRKGJWGPO-FLMPCSKASA-N |
| XLogP | 3.39 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|