C17H24O2 — CID 74932187
heptadeca-8,10-dien-4,6-diyne-1,14-diol (PubChem CID 74932187) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is heptadeca-8,10-dien-4,6-diyne-1,14-diol.
| Compound Name | heptadeca-8,10-dien-4,6-diyne-1,14-diol |
|---|---|
| PubChem CID | 74932187 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | heptadeca-8,10-dien-4,6-diyne-1,14-diol |
| SMILES | CCCC(O)CCC=CC=CC#CC#CCCCO |
| InChI | InChI=1S/C17H24O2/c1-2-14-17(19)15-12-10-8-6-4-3-5-7-9-11-13-16-18/h4,6,8,10,17-19H,2,11-16H2,1H3 |
| InChIKey | SZYKBBPFQKNSPD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|