About pentadec-13-en-11-ynyl acetate
pentadec-13-en-11-ynyl acetate (PubChem CID 154077168) has the molecular formula C17H28O2
and a molecular weight of 264.41 g/mol. Its IUPAC name is pentadec-13-en-11-ynyl acetate.
Molecular Properties
| Compound Name | pentadec-13-en-11-ynyl acetate |
| PubChem CID | 154077168 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | pentadec-13-en-11-ynyl acetate |
| SMILES | CC=CC#CCCCCCCCCCCOC(C)=O |
| InChI | InChI=1S/C17H28O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-17(2)18/h3-4H,7-16H2,1-2H3 |
| InChIKey | RTGFJAIXQWIBCL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze pentadec-13-en-11-ynyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentadec-13-en-11-ynyl acetate?
The IUPAC name of pentadec-13-en-11-ynyl acetate (CID 154077168) is pentadec-13-en-11-ynyl acetate.
What is the SMILES notation for pentadec-13-en-11-ynyl acetate?
The canonical SMILES for pentadec-13-en-11-ynyl acetate is CC=CC#CCCCCCCCCCCOC(C)=O.
What is the InChIKey of pentadec-13-en-11-ynyl acetate?
The InChIKey is RTGFJAIXQWIBCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-17(2)18/h3-4H,7-16H2,1-2H3.
What are the key properties of pentadec-13-en-11-ynyl acetate?
pentadec-13-en-11-ynyl acetate has a molecular weight of 264.41 g/mol, XLogP of 4.64, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentadec-13-en-11-ynyl acetate is sourced from PubChem (CID 154077168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).