C9H19NO — CID 99994244
(2R,4S)-2-butyl-4-methoxypyrrolidine (PubChem CID 99994244) has the molecular formula C9H19NO and a molecular weight of 157.26 g/mol. Its IUPAC name is (2R,4S)-2-butyl-4-methoxypyrrolidine.
| Compound Name | (2R,4S)-2-butyl-4-methoxypyrrolidine |
|---|---|
| PubChem CID | 99994244 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | (2R,4S)-2-butyl-4-methoxypyrrolidine |
| SMILES | CCCC[C@@H]1C[C@H](OC)CN1 |
| InChI | InChI=1S/C9H19NO/c1-3-4-5-8-6-9(11-2)7-10-8/h8-10H,3-7H2,1-2H3/t8-,9+/m1/s1 |
| InChIKey | BBEGDQUMGSRNDB-BDAKNGLRSA-N |
| XLogP | 1.55 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |