C7H12N2O — CID 118498498
2-[(2S,4R)-4-methoxypyrrolidin-2-yl]acetonitrile (PubChem CID 118498498) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is 2-[(2S,4R)-4-methoxypyrrolidin-2-yl]acetonitrile.
| Compound Name | 2-[(2S,4R)-4-methoxypyrrolidin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 118498498 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 2-[(2S,4R)-4-methoxypyrrolidin-2-yl]acetonitrile |
| SMILES | CO[C@H]1CN[C@@H](CC#N)C1 |
| InChI | InChI=1S/C7H12N2O/c1-10-7-4-6(2-3-8)9-5-7/h6-7,9H,2,4-5H2,1H3/t6-,7+/m0/s1 |
| InChIKey | UZYZHRDZWDSLQO-NKWVEPMBSA-N |
| XLogP | 0.28 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |