C20H38ClN3O — CID 11810817
[(1S,4R,5R,6S,10R)-6-methyl-10-nonyl-7,9-diaza-12-azoniatricyclo[6.3.1.04,12]dodec-8(12)-en-5-yl]methanol chloride (PubChem CID 11810817) has the molecular formula C20H38ClN3O and a molecular weight of 372.00 g/mol. Its IUPAC name is [(1S,4R,5R,6S,10R)-6-methyl-10-nonyl-7,9-diaza-12-azoniatricyclo[6.3.1.04,12]dodec-8(12)-en-5-yl]methanol chloride.
| Compound Name | [(1S,4R,5R,6S,10R)-6-methyl-10-nonyl-7,9-diaza-12-azoniatricyclo[6.3.1.04,12]dodec-8(12)-en-5-yl]methanol chloride |
|---|---|
| PubChem CID | 11810817 |
| Molecular Formula | C20H38ClN3O |
| Molecular Weight | 372.00 g/mol |
| Exact Mass | 371.27 |
| IUPAC Name | [(1S,4R,5R,6S,10R)-6-methyl-10-nonyl-7,9-diaza-12-azoniatricyclo[6.3.1.04,12]dodec-8(12)-en-5-yl]methanol chloride |
| SMILES | CCCCCCCCC[C@@H]1C[C@@H]2CC[C@@H]3[C@H](CO)[C@H](C)NC(=[N+]23)N1.[Cl-] |
| InChI | InChI=1S/C20H37N3O.ClH/c1-3-4-5-6-7-8-9-10-16-13-17-11-12-19-18(14-24)15(2)21-20(22-16)23(17)19;/h15-19,24H,3-14H2,1-2H3,(H,21,22);1H/t15-,16+,17-,18+,19+;/m0./s1 |
| InChIKey | ODJRSGFEBBVGGS-BMEKHTRRSA-N |
| XLogP | -0.01 |
| TPSA | 47.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.00 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|