C24H40CrN2 — CID 139164166
chromium(2+);bis(2,5-ditert-butylpyrrol-1-ide) (PubChem CID 139164166) has the molecular formula C24H40CrN2 and a molecular weight of 408.59 g/mol. Its IUPAC name is chromium(2+);bis(2,5-ditert-butylpyrrol-1-ide).
| Compound Name | chromium(2+);bis(2,5-ditert-butylpyrrol-1-ide) |
|---|---|
| PubChem CID | 139164166 |
| Molecular Formula | C24H40CrN2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | chromium(2+);bis(2,5-ditert-butylpyrrol-1-ide) |
| SMILES | CC(C)(C)c1ccc(C(C)(C)C)[n-]1.CC(C)(C)c1ccc(C(C)(C)C)[n-]1.[Cr+2] |
| InChI | InChI=1S/2C12H20N.Cr/c2*1-11(2,3)9-7-8-10(13-9)12(4,5)6;/h2*7-8H,1-6H3;/q2*-1;+2 |
| InChIKey | YPZGREUYMJNJDQ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |