lithium 2,4-ditert-butylimidazol-3-ide

C11H19LiN2 — CID 158739059

IUPAClithium 2,4-ditert-butylimidazol-3-ide
SMILESCC(C)(C)c1cnc(C(C)(C)C)[n-]1.[Li+]
InChIInChI=1S/C11H19N2.Li/c1-10(2,3)8-7-12-9(13-8)11(4,5)6;/h7H,1-6H3;/q-1;+1
InChIKeyIMAZYMLZTZSVJP-UHFFFAOYSA-N
MW186.23 g/mol
LogP-0.36
Rot. Bonds

About lithium 2,4-ditert-butylimidazol-3-ide

lithium 2,4-ditert-butylimidazol-3-ide (PubChem CID 158739059) has the molecular formula C11H19LiN2 and a molecular weight of 186.23 g/mol. Its IUPAC name is lithium 2,4-ditert-butylimidazol-3-ide.

Molecular Properties

Compound Namelithium 2,4-ditert-butylimidazol-3-ide
PubChem CID158739059
Molecular FormulaC11H19LiN2
Molecular Weight186.23 g/mol
Exact Mass186.17
IUPAC Namelithium 2,4-ditert-butylimidazol-3-ide
SMILESCC(C)(C)c1cnc(C(C)(C)C)[n-]1.[Li+]
InChIInChI=1S/C11H19N2.Li/c1-10(2,3)8-7-12-9(13-8)11(4,5)6;/h7H,1-6H3;/q-1;+1
InChIKeyIMAZYMLZTZSVJP-UHFFFAOYSA-N
XLogP-0.36
TPSA26.99 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.23
LogP ≤ 5-0.36
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Analyze lithium 2,4-ditert-butylimidazol-3-ide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of lithium 2,4-ditert-butylimidazol-3-ide?
The IUPAC name of lithium 2,4-ditert-butylimidazol-3-ide (CID 158739059) is lithium 2,4-ditert-butylimidazol-3-ide.
What is the SMILES notation for lithium 2,4-ditert-butylimidazol-3-ide?
The canonical SMILES for lithium 2,4-ditert-butylimidazol-3-ide is CC(C)(C)c1cnc(C(C)(C)C)[n-]1.[Li+].
What is the InChIKey of lithium 2,4-ditert-butylimidazol-3-ide?
The InChIKey is IMAZYMLZTZSVJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N2.Li/c1-10(2,3)8-7-12-9(13-8)11(4,5)6;/h7H,1-6H3;/q-1;+1.
What are the key properties of lithium 2,4-ditert-butylimidazol-3-ide?
lithium 2,4-ditert-butylimidazol-3-ide has a molecular weight of 186.23 g/mol, XLogP of -0.36, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 2,4-ditert-butylimidazol-3-ide is sourced from PubChem (CID 158739059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).