C26H30 — CID 102076413
(10bS,10cS)-2,7-ditert-butyl-10b,10c-dimethyl-9,10-didehydropyrene (PubChem CID 102076413) has the molecular formula C26H30 and a molecular weight of 342.53 g/mol. Its IUPAC name is (10bS,10cS)-2,7-ditert-butyl-10b,10c-dimethyl-9,10-didehydropyrene.
| Compound Name | (10bS,10cS)-2,7-ditert-butyl-10b,10c-dimethyl-9,10-didehydropyrene |
|---|---|
| PubChem CID | 102076413 |
| Molecular Formula | C26H30 |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | (10bS,10cS)-2,7-ditert-butyl-10b,10c-dimethyl-9,10-didehydropyrene |
| SMILES | CC(C)(C)C1=CC2=CC=C3C=C(C(C)(C)C)C=C4C#CC(=C1)[C@@]2(C)[C@]43C |
| InChI | InChI=1S/C26H30/c1-23(2,3)21-13-17-9-11-19-15-22(24(4,5)6)16-20-12-10-18(14-21)25(17,7)26(19,20)8/h9,11,13-16H,1-8H3/t25-,26-/m0/s1 |
| InChIKey | SLCWGWAENYXURG-UIOOFZCWSA-N |
| XLogP | 6.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|