About 1,4-ditert-butyl-5,5-dimethylcyclopenta-1,3-diene
1,4-ditert-butyl-5,5-dimethylcyclopenta-1,3-diene (PubChem CID 158400827) has the molecular formula C15H26
and a molecular weight of 206.37 g/mol. Its IUPAC name is 1,4-ditert-butyl-5,5-dimethylcyclopenta-1,3-diene.
Analyze 1,4-ditert-butyl-5,5-dimethylcyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-ditert-butyl-5,5-dimethylcyclopenta-1,3-diene?
The IUPAC name of 1,4-ditert-butyl-5,5-dimethylcyclopenta-1,3-diene (CID 158400827) is 1,4-ditert-butyl-5,5-dimethylcyclopenta-1,3-diene.
What is the SMILES notation for 1,4-ditert-butyl-5,5-dimethylcyclopenta-1,3-diene?
The canonical SMILES for 1,4-ditert-butyl-5,5-dimethylcyclopenta-1,3-diene is CC(C)(C)C1=CC=C(C(C)(C)C)C1(C)C.
What is the InChIKey of 1,4-ditert-butyl-5,5-dimethylcyclopenta-1,3-diene?
The InChIKey is UZQUSNWDLIMQRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26/c1-13(2,3)11-9-10-12(14(4,5)6)15(11,7)8/h9-10H,1-8H3.
What are the key properties of 1,4-ditert-butyl-5,5-dimethylcyclopenta-1,3-diene?
1,4-ditert-butyl-5,5-dimethylcyclopenta-1,3-diene has a molecular weight of 206.37 g/mol, XLogP of 4.97, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-ditert-butyl-5,5-dimethylcyclopenta-1,3-diene is sourced from PubChem (CID 158400827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).