C23H30N4S2 — CID 159227032
1,2-bis[(2-aminophenyl)sulfanyl]-6-tert-butyl-2-methylcyclohexa-3,5-diene-1,3-diamine (PubChem CID 159227032) has the molecular formula C23H30N4S2 and a molecular weight of 426.66 g/mol. Its IUPAC name is 1,2-bis[(2-aminophenyl)sulfanyl]-6-tert-butyl-2-methylcyclohexa-3,5-diene-1,3-diamine.
| Compound Name | 1,2-bis[(2-aminophenyl)sulfanyl]-6-tert-butyl-2-methylcyclohexa-3,5-diene-1,3-diamine |
|---|---|
| PubChem CID | 159227032 |
| Molecular Formula | C23H30N4S2 |
| Molecular Weight | 426.66 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 1,2-bis[(2-aminophenyl)sulfanyl]-6-tert-butyl-2-methylcyclohexa-3,5-diene-1,3-diamine |
| SMILES | CC(C)(C)C1=CC=C(N)C(C)(Sc2ccccc2N)C1(N)Sc1ccccc1N |
| InChI | InChI=1S/C23H30N4S2/c1-21(2,3)19-13-14-20(26)22(4,28-17-11-7-5-9-15(17)24)23(19,27)29-18-12-8-6-10-16(18)25/h5-14H,24-27H2,1-4H3 |
| InChIKey | KSKNGKHCAFTAFQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.66 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|