C14H25Al — CID 174392215
alumane;1,3-ditert-butylbenzene (PubChem CID 174392215) has the molecular formula C14H25Al and a molecular weight of 220.34 g/mol. Its IUPAC name is alumane;1,3-ditert-butylbenzene.
| Compound Name | alumane;1,3-ditert-butylbenzene |
|---|---|
| PubChem CID | 174392215 |
| Molecular Formula | C14H25Al |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | alumane;1,3-ditert-butylbenzene |
| SMILES | CC(C)(C)c1cccc(C(C)(C)C)c1.[AlH3] |
| InChI | InChI=1S/C14H22.Al.3H/c1-13(2,3)11-8-7-9-12(10-11)14(4,5)6;;;;/h7-10H,1-6H3;;;; |
| InChIKey | STFUBTPWLLOSFN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |