C23H28Br2S — CID 123175962
4,5-dibromo-2,7-ditert-butyl-9,9-dimethylthioxanthene (PubChem CID 123175962) has the molecular formula C23H28Br2S and a molecular weight of 496.35 g/mol. Its IUPAC name is 4,5-dibromo-2,7-ditert-butyl-9,9-dimethylthioxanthene.
| Compound Name | 4,5-dibromo-2,7-ditert-butyl-9,9-dimethylthioxanthene |
|---|---|
| PubChem CID | 123175962 |
| Molecular Formula | C23H28Br2S |
| Molecular Weight | 496.35 g/mol |
| Exact Mass | 494.03 |
| IUPAC Name | 4,5-dibromo-2,7-ditert-butyl-9,9-dimethylthioxanthene |
| SMILES | CC(C)(C)c1cc(Br)c2c(c1)C(C)(C)c1cc(C(C)(C)C)cc(Br)c1S2 |
| InChI | InChI=1S/C23H28Br2S/c1-21(2,3)13-9-15-19(17(24)11-13)26-20-16(23(15,7)8)10-14(12-18(20)25)22(4,5)6/h9-12H,1-8H3 |
| InChIKey | CQGUYVNVWJTWIM-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.35 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |