C37H42BrNO3 — CID 146405273
5-bromo-2,7-ditert-butyl-N,N-bis(4-methoxyphenyl)-9,9-dimethylxanthen-4-amine (PubChem CID 146405273) has the molecular formula C37H42BrNO3 and a molecular weight of 628.65 g/mol. Its IUPAC name is 5-bromo-2,7-ditert-butyl-N,N-bis(4-methoxyphenyl)-9,9-dimethylxanthen-4-amine.
| Compound Name | 5-bromo-2,7-ditert-butyl-N,N-bis(4-methoxyphenyl)-9,9-dimethylxanthen-4-amine |
|---|---|
| PubChem CID | 146405273 |
| Molecular Formula | C37H42BrNO3 |
| Molecular Weight | 628.65 g/mol |
| Exact Mass | 627.23 |
| IUPAC Name | 5-bromo-2,7-ditert-butyl-N,N-bis(4-methoxyphenyl)-9,9-dimethylxanthen-4-amine |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2cc(C(C)(C)C)cc3c2Oc2c(Br)cc(C(C)(C)C)cc2C3(C)C)cc1 |
| InChI | InChI=1S/C37H42BrNO3/c1-35(2,3)23-19-29-33(31(38)21-23)42-34-30(37(29,7)8)20-24(36(4,5)6)22-32(34)39(25-11-15-27(40-9)16-12-25)26-13-17-28(41-10)18-14-26/h11-22H,1-10H3 |
| InChIKey | UAVUYDCKVXYSSM-UHFFFAOYSA-N |
| XLogP | 10.96 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.65 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |