C28H32O — CID 101391593
9,16-ditert-butyl-18,19-dimethyl-4-oxaheptacyclo[9.6.2.02,5.02,6.03,6.07,19.014,18]nonadeca-1(17),7,9,11,13,15-hexaene (PubChem CID 101391593) has the molecular formula C28H32O and a molecular weight of 384.56 g/mol. Its IUPAC name is 9,16-ditert-butyl-18,19-dimethyl-4-oxaheptacyclo[9.6.2.02,5.02,6.03,6.07,19.014,18]nonadeca-1(17),7,9,11,13,15-hexaene.
| Compound Name | 9,16-ditert-butyl-18,19-dimethyl-4-oxaheptacyclo[9.6.2.02,5.02,6.03,6.07,19.014,18]nonadeca-1(17),7,9,11,13,15-hexaene |
|---|---|
| PubChem CID | 101391593 |
| Molecular Formula | C28H32O |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 9,16-ditert-butyl-18,19-dimethyl-4-oxaheptacyclo[9.6.2.02,5.02,6.03,6.07,19.014,18]nonadeca-1(17),7,9,11,13,15-hexaene |
| SMILES | CC(C)(C)C1=CC2=CC=C3C=C(C(C)(C)C)C=C4C3(C)C2(C)C(=C1)C12C3OC1C432 |
| InChI | InChI=1S/C28H32O/c1-23(2,3)17-11-15-9-10-16-12-18(24(4,5)6)14-20-26(16,8)25(15,7)19(13-17)27-21-28(20,27)22(27)29-21/h9-14,21-22H,1-8H3 |
| InChIKey | KVRYNAZTKWXUKK-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |