C34H38 — CID 11496040
10,21-ditert-butyl-23,24-dimethylpentacyclo[17.3.1.18,12.02,7.013,18]tetracosa-1,3,5,7,9,11,13,15,17,19,21-undecaene (PubChem CID 11496040) has the molecular formula C34H38 and a molecular weight of 446.68 g/mol. Its IUPAC name is 10,21-ditert-butyl-23,24-dimethylpentacyclo[17.3.1.18,12.02,7.013,18]tetracosa-1,3,5,7,9,11,13,15,17,19,21-undecaene.
| Compound Name | 10,21-ditert-butyl-23,24-dimethylpentacyclo[17.3.1.18,12.02,7.013,18]tetracosa-1,3,5,7,9,11,13,15,17,19,21-undecaene |
|---|---|
| PubChem CID | 11496040 |
| Molecular Formula | C34H38 |
| Molecular Weight | 446.68 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | 10,21-ditert-butyl-23,24-dimethylpentacyclo[17.3.1.18,12.02,7.013,18]tetracosa-1,3,5,7,9,11,13,15,17,19,21-undecaene |
| SMILES | CC1C2=CC(C(C)(C)C)=C/C1=c1\cccc\c1=C1/C=C(C(C)(C)C)C=C(c3ccccc32)C1C |
| InChI | InChI=1S/C34H38/c1-21-29-17-23(33(3,4)5)18-30(21)26-14-10-12-16-28(26)32-20-24(34(6,7)8)19-31(22(32)2)27-15-11-9-13-25(27)29/h9-22H,1-8H3/b29-25-,30-26-,31-27-,32-28- |
| InChIKey | SHSFQFJAKOJRAG-ZRTCEIMWSA-N |
| XLogP | 7.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.68 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |