C16H24Si — CID 134888721
(3-tert-butyl-1H-inden-1-yl)-trimethylsilane (PubChem CID 134888721) has the molecular formula C16H24Si and a molecular weight of 244.45 g/mol. Its IUPAC name is (3-tert-butyl-1H-inden-1-yl)-trimethylsilane.
| Compound Name | (3-tert-butyl-1H-inden-1-yl)-trimethylsilane |
|---|---|
| PubChem CID | 134888721 |
| Molecular Formula | C16H24Si |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | (3-tert-butyl-1H-inden-1-yl)-trimethylsilane |
| SMILES | CC(C)(C)C1=CC([Si](C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C16H24Si/c1-16(2,3)14-11-15(17(4,5)6)13-10-8-7-9-12(13)14/h7-11,15H,1-6H3 |
| InChIKey | JVXWDGKGCNZPOF-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|