C32H34 — CID 54376267
15-tert-butyl-10-(3-tert-butyl-1H-inden-1-yl)tetracyclo[7.6.0.02,7.011,14]pentadeca-1(15),2,4,6,9,11(14)-hexaene (PubChem CID 54376267) has the molecular formula C32H34 and a molecular weight of 418.62 g/mol. Its IUPAC name is 15-tert-butyl-10-(3-tert-butyl-1H-inden-1-yl)tetracyclo[7.6.0.02,7.011,14]pentadeca-1(15),2,4,6,9,11(14)-hexaene.
| Compound Name | 15-tert-butyl-10-(3-tert-butyl-1H-inden-1-yl)tetracyclo[7.6.0.02,7.011,14]pentadeca-1(15),2,4,6,9,11(14)-hexaene |
|---|---|
| PubChem CID | 54376267 |
| Molecular Formula | C32H34 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | 15-tert-butyl-10-(3-tert-butyl-1H-inden-1-yl)tetracyclo[7.6.0.02,7.011,14]pentadeca-1(15),2,4,6,9,11(14)-hexaene |
| SMILES | CC(C)(C)C1=CC(c2c3c(c(C(C)(C)C)c4c2Cc2ccccc2-4)CC3)c2ccccc21 |
| InChI | InChI=1S/C32H34/c1-31(2,3)27-18-25(21-13-9-10-14-22(21)27)28-23-15-16-24(23)30(32(4,5)6)29-20-12-8-7-11-19(20)17-26(28)29/h7-14,18,25H,15-17H2,1-6H3 |
| InChIKey | FLUYGVQZDXSOLY-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |