C16H11Cl3O3 — CID 151836877
2-(2,3,4-trichloro-9H-fluoren-1-yl)-1,3,5-trioxane (PubChem CID 151836877) has the molecular formula C16H11Cl3O3 and a molecular weight of 357.62 g/mol. Its IUPAC name is 2-(2,3,4-trichloro-9H-fluoren-1-yl)-1,3,5-trioxane.
| Compound Name | 2-(2,3,4-trichloro-9H-fluoren-1-yl)-1,3,5-trioxane |
|---|---|
| PubChem CID | 151836877 |
| Molecular Formula | C16H11Cl3O3 |
| Molecular Weight | 357.62 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | 2-(2,3,4-trichloro-9H-fluoren-1-yl)-1,3,5-trioxane |
| SMILES | Clc1c(Cl)c2c(c(C3OCOCO3)c1Cl)Cc1ccccc1-2 |
| InChI | InChI=1S/C16H11Cl3O3/c17-13-11-9-4-2-1-3-8(9)5-10(11)12(14(18)15(13)19)16-21-6-20-7-22-16/h1-4,16H,5-7H2 |
| InChIKey | SFVOTBWWGIOJLH-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.62 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|