C13H8Cl2 — CID 101371792
2,4-dichloro-9H-fluorene (PubChem CID 101371792) has the molecular formula C13H8Cl2 and a molecular weight of 235.11 g/mol. Its IUPAC name is 2,4-dichloro-9H-fluorene.
| Compound Name | 2,4-dichloro-9H-fluorene |
|---|---|
| PubChem CID | 101371792 |
| Molecular Formula | C13H8Cl2 |
| Molecular Weight | 235.11 g/mol |
| Exact Mass | 234.00 |
| IUPAC Name | 2,4-dichloro-9H-fluorene |
| SMILES | Clc1cc(Cl)c2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H8Cl2/c14-10-6-9-5-8-3-1-2-4-11(8)13(9)12(15)7-10/h1-4,6-7H,5H2 |
| InChIKey | XTRGAVVWOJHWPK-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.11 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |