About benzene;3,4-dibromo-9H-fluorene
benzene;3,4-dibromo-9H-fluorene (PubChem CID 159679673) has the molecular formula C19H14Br2
and a molecular weight of 402.13 g/mol. Its IUPAC name is benzene;3,4-dibromo-9H-fluorene.
Molecular Properties
| Compound Name | benzene;3,4-dibromo-9H-fluorene |
| PubChem CID | 159679673 |
| Molecular Formula | C19H14Br2 |
| Molecular Weight | 402.13 g/mol |
| Exact Mass | 399.95 |
| IUPAC Name | benzene;3,4-dibromo-9H-fluorene |
| SMILES | Brc1ccc2c(c1Br)-c1ccccc1C2.c1ccccc1 |
| InChI | InChI=1S/C13H8Br2.C6H6/c14-11-6-5-9-7-8-3-1-2-4-10(8)12(9)13(11)15;1-2-4-6-5-3-1/h1-6H,7H2;1-6H |
| InChIKey | MVBCJOUIRVJJCN-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.13 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze benzene;3,4-dibromo-9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;3,4-dibromo-9H-fluorene?
The IUPAC name of benzene;3,4-dibromo-9H-fluorene (CID 159679673) is benzene;3,4-dibromo-9H-fluorene.
What is the SMILES notation for benzene;3,4-dibromo-9H-fluorene?
The canonical SMILES for benzene;3,4-dibromo-9H-fluorene is Brc1ccc2c(c1Br)-c1ccccc1C2.c1ccccc1.
What is the InChIKey of benzene;3,4-dibromo-9H-fluorene?
The InChIKey is MVBCJOUIRVJJCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8Br2.C6H6/c14-11-6-5-9-7-8-3-1-2-4-10(8)12(9)13(11)15;1-2-4-6-5-3-1/h1-6H,7H2;1-6H.
What are the key properties of benzene;3,4-dibromo-9H-fluorene?
benzene;3,4-dibromo-9H-fluorene has a molecular weight of 402.13 g/mol, XLogP of 6.47, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;3,4-dibromo-9H-fluorene is sourced from PubChem (CID 159679673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).