C19H13Br — CID 157361049
5-bromo-3-phenyl-9H-fluorene (PubChem CID 157361049) has the molecular formula C19H13Br and a molecular weight of 321.22 g/mol. Its IUPAC name is 5-bromo-3-phenyl-9H-fluorene.
| Compound Name | 5-bromo-3-phenyl-9H-fluorene |
|---|---|
| PubChem CID | 157361049 |
| Molecular Formula | C19H13Br |
| Molecular Weight | 321.22 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 5-bromo-3-phenyl-9H-fluorene |
| SMILES | Brc1cccc2c1-c1cc(-c3ccccc3)ccc1C2 |
| InChI | InChI=1S/C19H13Br/c20-18-8-4-7-16-11-15-10-9-14(12-17(15)19(16)18)13-5-2-1-3-6-13/h1-10,12H,11H2 |
| InChIKey | CXRGMLGUZBQBAE-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.22 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |