C27H12Br8O3-2 — CID 19940173
bis(1,2,3,4-tetrabromo-9H-fluorene);carbonate (PubChem CID 19940173) has the molecular formula C27H12Br8O3-2 and a molecular weight of 1023.62 g/mol. Its IUPAC name is bis(1,2,3,4-tetrabromo-9H-fluorene);carbonate.
| Compound Name | bis(1,2,3,4-tetrabromo-9H-fluorene);carbonate |
|---|---|
| PubChem CID | 19940173 |
| Molecular Formula | C27H12Br8O3-2 |
| Molecular Weight | 1023.62 g/mol |
| Exact Mass | 1015.43 |
| IUPAC Name | bis(1,2,3,4-tetrabromo-9H-fluorene);carbonate |
| SMILES | Brc1c(Br)c(Br)c2c(c1Br)Cc1ccccc1-2.Brc1c(Br)c(Br)c2c(c1Br)Cc1ccccc1-2.O=C([O-])[O-] |
| InChI | InChI=1S/2C13H6Br4.CH2O3/c2*14-10-8-5-6-3-1-2-4-7(6)9(8)11(15)13(17)12(10)16;2-1(3)4/h2*1-4H,5H2;(H2,2,3,4)/p-2 |
| InChIKey | FOJPUXMRBRVMOB-UHFFFAOYSA-L |
| XLogP | 10.17 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1023.62 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|