C27H36Si2 — CID 101175516
trimethyl-[(3S)-3-[2-[(1S)-3-trimethylsilyl-1H-inden-1-yl]propan-2-yl]-3H-inden-1-yl]silane (PubChem CID 101175516) has the molecular formula C27H36Si2 and a molecular weight of 416.76 g/mol. Its IUPAC name is trimethyl-[(3S)-3-[2-[(1S)-3-trimethylsilyl-1H-inden-1-yl]propan-2-yl]-3H-inden-1-yl]silane.
| Compound Name | trimethyl-[(3S)-3-[2-[(1S)-3-trimethylsilyl-1H-inden-1-yl]propan-2-yl]-3H-inden-1-yl]silane |
|---|---|
| PubChem CID | 101175516 |
| Molecular Formula | C27H36Si2 |
| Molecular Weight | 416.76 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | trimethyl-[(3S)-3-[2-[(1S)-3-trimethylsilyl-1H-inden-1-yl]propan-2-yl]-3H-inden-1-yl]silane |
| SMILES | CC(C)([C@@H]1C=C([Si](C)(C)C)c2ccccc21)[C@@H]1C=C([Si](C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C27H36Si2/c1-27(2,23-17-25(28(3,4)5)21-15-11-9-13-19(21)23)24-18-26(29(6,7)8)22-16-12-10-14-20(22)24/h9-18,23-24H,1-8H3/t23-,24-/m1/s1 |
| InChIKey | VVKMEOLCMHKYFM-DNQXCXABSA-N |
| XLogP | 8.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.76 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|