C28H42Si4 — CID 100983120
[dimethyl-(3-trimethylsilyl-1H-inden-1-yl)silyl]-dimethyl-(3-trimethylsilyl-1H-inden-1-yl)silane (PubChem CID 100983120) has the molecular formula C28H42Si4 and a molecular weight of 490.99 g/mol. Its IUPAC name is [dimethyl-(3-trimethylsilyl-1H-inden-1-yl)silyl]-dimethyl-(3-trimethylsilyl-1H-inden-1-yl)silane.
| Compound Name | [dimethyl-(3-trimethylsilyl-1H-inden-1-yl)silyl]-dimethyl-(3-trimethylsilyl-1H-inden-1-yl)silane |
|---|---|
| PubChem CID | 100983120 |
| Molecular Formula | C28H42Si4 |
| Molecular Weight | 490.99 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | [dimethyl-(3-trimethylsilyl-1H-inden-1-yl)silyl]-dimethyl-(3-trimethylsilyl-1H-inden-1-yl)silane |
| SMILES | C[Si](C)(C)C1=CC([Si](C)(C)[Si](C)(C)C2C=C([Si](C)(C)C)c3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C28H42Si4/c1-29(2,3)25-19-27(23-17-13-11-15-21(23)25)31(7,8)32(9,10)28-20-26(30(4,5)6)22-16-12-14-18-24(22)28/h11-20,27-28H,1-10H3 |
| InChIKey | MQLZCDYGHDMMGE-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.99 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|