C26H32Si2 — CID 139054939
trimethyl-[(1S,2S)-14-trimethylsilyl-9-pentacyclo[11.7.0.02,10.03,8.015,20]icosa-3,5,7,9,13,15,17,19-octaenyl]silane (PubChem CID 139054939) has the molecular formula C26H32Si2 and a molecular weight of 400.71 g/mol. Its IUPAC name is trimethyl-[(1S,2S)-14-trimethylsilyl-9-pentacyclo[11.7.0.02,10.03,8.015,20]icosa-3,5,7,9,13,15,17,19-octaenyl]silane.
| Compound Name | trimethyl-[(1S,2S)-14-trimethylsilyl-9-pentacyclo[11.7.0.02,10.03,8.015,20]icosa-3,5,7,9,13,15,17,19-octaenyl]silane |
|---|---|
| PubChem CID | 139054939 |
| Molecular Formula | C26H32Si2 |
| Molecular Weight | 400.71 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | trimethyl-[(1S,2S)-14-trimethylsilyl-9-pentacyclo[11.7.0.02,10.03,8.015,20]icosa-3,5,7,9,13,15,17,19-octaenyl]silane |
| SMILES | C[Si](C)(C)C1=C2CCC3=C([Si](C)(C)C)c4ccccc4[C@@H]3[C@H]2c2ccccc21 |
| InChI | InChI=1S/C26H32Si2/c1-27(2,3)25-19-13-9-7-11-17(19)23-21(25)15-16-22-24(23)18-12-8-10-14-20(18)26(22)28(4,5)6/h7-14,23-24H,15-16H2,1-6H3/t23-,24-/m0/s1 |
| InChIKey | CMTPECZOOFPPPB-ZEQRLZLVSA-N |
| XLogP | 7.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.71 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|