About dichlorochromium(1+);ethane;trimethyl-[3-(2-pyridin-2-ylethyl)-3H-inden-1-yl]silane
dichlorochromium(1+);ethane;trimethyl-[3-(2-pyridin-2-ylethyl)-3H-inden-1-yl]silane (PubChem CID 146899518) has the molecular formula C21H28Cl2CrNSi
and a molecular weight of 445.45 g/mol. Its IUPAC name is dichlorochromium(1+);ethane;trimethyl-[3-(2-pyridin-2-ylethyl)-3H-inden-1-yl]silane.
Molecular Properties
| Compound Name | dichlorochromium(1+);ethane;trimethyl-[3-(2-pyridin-2-ylethyl)-3H-inden-1-yl]silane |
| PubChem CID | 146899518 |
| Molecular Formula | C21H28Cl2CrNSi |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | dichlorochromium(1+);ethane;trimethyl-[3-(2-pyridin-2-ylethyl)-3H-inden-1-yl]silane |
| SMILES | C[Si](C)(C)C1=CC(CCc2ccccn2)c2ccccc21.Cl[Cr+]Cl.[CH2-]C |
| InChI | InChI=1S/C19H23NSi.C2H5.2ClH.Cr/c1-21(2,3)19-14-15(17-9-4-5-10-18(17)19)11-12-16-8-6-7-13-20-16;1-2;;;/h4-10,13-15H,11-12H2,1-3H3;1H2,2H3;2*1H;/q;-1;;;+3/p-2 |
| InChIKey | OPVMKYBAXXFJDL-UHFFFAOYSA-L |
| XLogP | 7.29 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dichlorochromium(1+);ethane;trimethyl-[3-(2-pyridin-2-ylethyl)-3H-inden-1-yl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorochromium(1+);ethane;trimethyl-[3-(2-pyridin-2-ylethyl)-3H-inden-1-yl]silane?
The IUPAC name of dichlorochromium(1+);ethane;trimethyl-[3-(2-pyridin-2-ylethyl)-3H-inden-1-yl]silane (CID 146899518) is dichlorochromium(1+);ethane;trimethyl-[3-(2-pyridin-2-ylethyl)-3H-inden-1-yl]silane.
What is the SMILES notation for dichlorochromium(1+);ethane;trimethyl-[3-(2-pyridin-2-ylethyl)-3H-inden-1-yl]silane?
The canonical SMILES for dichlorochromium(1+);ethane;trimethyl-[3-(2-pyridin-2-ylethyl)-3H-inden-1-yl]silane is C[Si](C)(C)C1=CC(CCc2ccccn2)c2ccccc21.Cl[Cr+]Cl.[CH2-]C.
What is the InChIKey of dichlorochromium(1+);ethane;trimethyl-[3-(2-pyridin-2-ylethyl)-3H-inden-1-yl]silane?
The InChIKey is OPVMKYBAXXFJDL-UHFFFAOYSA-L. The full InChI is InChI=1S/C19H23NSi.C2H5.2ClH.Cr/c1-21(2,3)19-14-15(17-9-4-5-10-18(17)19)11-12-16-8-6-7-13-20-16;1-2;;;/h4-10,13-15H,11-12H2,1-3H3;1H2,2H3;2*1H;/q;-1;;;+3/p-2.
What are the key properties of dichlorochromium(1+);ethane;trimethyl-[3-(2-pyridin-2-ylethyl)-3H-inden-1-yl]silane?
dichlorochromium(1+);ethane;trimethyl-[3-(2-pyridin-2-ylethyl)-3H-inden-1-yl]silane has a molecular weight of 445.45 g/mol, XLogP of 7.29, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorochromium(1+);ethane;trimethyl-[3-(2-pyridin-2-ylethyl)-3H-inden-1-yl]silane is sourced from PubChem (CID 146899518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).