C28H34Cl2SiZr — CID 175329499
bis(3-tert-butyl-2-chloro-1H-inden-1-yl)-dimethylsilane;zirconium (PubChem CID 175329499) has the molecular formula C28H34Cl2SiZr and a molecular weight of 560.80 g/mol. Its IUPAC name is bis(3-tert-butyl-2-chloro-1H-inden-1-yl)-dimethylsilane;zirconium.
| Compound Name | bis(3-tert-butyl-2-chloro-1H-inden-1-yl)-dimethylsilane;zirconium |
|---|---|
| PubChem CID | 175329499 |
| Molecular Formula | C28H34Cl2SiZr |
| Molecular Weight | 560.80 g/mol |
| Exact Mass | 558.09 |
| IUPAC Name | bis(3-tert-butyl-2-chloro-1H-inden-1-yl)-dimethylsilane;zirconium |
| SMILES | CC(C)(C)C1=C(Cl)C([Si](C)(C)C2C(Cl)=C(C(C)(C)C)c3ccccc32)c2ccccc21.[Zr] |
| InChI | InChI=1S/C28H34Cl2Si.Zr/c1-27(2,3)21-17-13-9-11-15-19(17)25(23(21)29)31(7,8)26-20-16-12-10-14-18(20)22(24(26)30)28(4,5)6;/h9-16,25-26H,1-8H3; |
| InChIKey | QQVXGNFJSPSYCM-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.80 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|