C33H30Cl2Si — CID 140967319
1,1-dichlorohex-5-enyl-bis(9H-fluoren-9-yl)-methylsilane (PubChem CID 140967319) has the molecular formula C33H30Cl2Si and a molecular weight of 525.60 g/mol. Its IUPAC name is 1,1-dichlorohex-5-enyl-bis(9H-fluoren-9-yl)-methylsilane.
| Compound Name | 1,1-dichlorohex-5-enyl-bis(9H-fluoren-9-yl)-methylsilane |
|---|---|
| PubChem CID | 140967319 |
| Molecular Formula | C33H30Cl2Si |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | 1,1-dichlorohex-5-enyl-bis(9H-fluoren-9-yl)-methylsilane |
| SMILES | C=CCCCC(Cl)(Cl)[Si](C)(C1c2ccccc2-c2ccccc21)C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C33H30Cl2Si/c1-3-4-13-22-33(34,35)36(2,31-27-18-9-5-14-23(27)24-15-6-10-19-28(24)31)32-29-20-11-7-16-25(29)26-17-8-12-21-30(26)32/h3,5-12,14-21,31-32H,1,4,13,22H2,2H3 |
| InChIKey | FYAABRMXRHSZEH-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|