C29H35NO4 — CID 68667175
ethyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-pent-4-enylhept-6-enoate (PubChem CID 68667175) has the molecular formula C29H35NO4 and a molecular weight of 461.60 g/mol. Its IUPAC name is ethyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-pent-4-enylhept-6-enoate.
| Compound Name | ethyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-pent-4-enylhept-6-enoate |
|---|---|
| PubChem CID | 68667175 |
| Molecular Formula | C29H35NO4 |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | ethyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-pent-4-enylhept-6-enoate |
| SMILES | C=CCCCC(CCCC=C)(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OCC |
| InChI | InChI=1S/C29H35NO4/c1-4-7-13-19-29(20-14-8-5-2,27(31)33-6-3)30-28(32)34-21-26-24-17-11-9-15-22(24)23-16-10-12-18-25(23)26/h4-5,9-12,15-18,26H,1-2,6-8,13-14,19-21H2,3H3,(H,30,32) |
| InChIKey | PLBZDKLBSJCDFU-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|