C35H40N2O5 — CID 122418787
(2R)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]amino]-2-methyldec-9-enoic acid (PubChem CID 122418787) has the molecular formula C35H40N2O5 and a molecular weight of 568.71 g/mol. Its IUPAC name is (2R)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]amino]-2-methyldec-9-enoic acid.
| Compound Name | (2R)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]amino]-2-methyldec-9-enoic acid |
|---|---|
| PubChem CID | 122418787 |
| Molecular Formula | C35H40N2O5 |
| Molecular Weight | 568.71 g/mol |
| Exact Mass | 568.29 |
| IUPAC Name | (2R)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]amino]-2-methyldec-9-enoic acid |
| SMILES | C=CCCCCCC[C@@](C)(NC(=O)[C@H](Cc1ccccc1)NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C35H40N2O5/c1-3-4-5-6-7-15-22-35(2,33(39)40)37-32(38)31(23-25-16-9-8-10-17-25)36-34(41)42-24-30-28-20-13-11-18-26(28)27-19-12-14-21-29(27)30/h3,8-14,16-21,30-31H,1,4-7,15,22-24H2,2H3,(H,36,41)(H,37,38)(H,39,40)/t31-,35+/m0/s1 |
| InChIKey | ZABUWZJFTVBPJN-MFACQUFMSA-N |
| XLogP | 6.62 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.71 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|