C26H33NO3 — CID 123135970
2-(9H-fluoren-9-ylmethoxymethylamino)-2-methyldec-9-enoic acid (PubChem CID 123135970) has the molecular formula C26H33NO3 and a molecular weight of 407.55 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylmethoxymethylamino)-2-methyldec-9-enoic acid.
| Compound Name | 2-(9H-fluoren-9-ylmethoxymethylamino)-2-methyldec-9-enoic acid |
|---|---|
| PubChem CID | 123135970 |
| Molecular Formula | C26H33NO3 |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | 2-(9H-fluoren-9-ylmethoxymethylamino)-2-methyldec-9-enoic acid |
| SMILES | C=CCCCCCCC(C)(NCOCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C26H33NO3/c1-3-4-5-6-7-12-17-26(2,25(28)29)27-19-30-18-24-22-15-10-8-13-20(22)21-14-9-11-16-23(21)24/h3,8-11,13-16,24,27H,1,4-7,12,17-19H2,2H3,(H,28,29) |
| InChIKey | ZZPBOXDCSGVQEZ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|