C19H17ClSi — CID 154420413
chloro-cyclopenta-2,4-dien-1-yl-(9H-fluoren-9-yl)-methylsilane (PubChem CID 154420413) has the molecular formula C19H17ClSi and a molecular weight of 308.88 g/mol. Its IUPAC name is chloro-cyclopenta-2,4-dien-1-yl-(9H-fluoren-9-yl)-methylsilane.
| Compound Name | chloro-cyclopenta-2,4-dien-1-yl-(9H-fluoren-9-yl)-methylsilane |
|---|---|
| PubChem CID | 154420413 |
| Molecular Formula | C19H17ClSi |
| Molecular Weight | 308.88 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | chloro-cyclopenta-2,4-dien-1-yl-(9H-fluoren-9-yl)-methylsilane |
| SMILES | C[Si](Cl)(C1C=CC=C1)C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C19H17ClSi/c1-21(20,14-8-2-3-9-14)19-17-12-6-4-10-15(17)16-11-5-7-13-18(16)19/h2-14,19H,1H3 |
| InChIKey | ASKXKLKPJMASHF-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.88 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|