C24H25Cl3Si — CID 154420962
trichloro-[5-cyclopenta-2,4-dien-1-yl-5-(9H-fluoren-9-yl)hexyl]silane (PubChem CID 154420962) has the molecular formula C24H25Cl3Si and a molecular weight of 447.91 g/mol. Its IUPAC name is trichloro-[5-cyclopenta-2,4-dien-1-yl-5-(9H-fluoren-9-yl)hexyl]silane.
| Compound Name | trichloro-[5-cyclopenta-2,4-dien-1-yl-5-(9H-fluoren-9-yl)hexyl]silane |
|---|---|
| PubChem CID | 154420962 |
| Molecular Formula | C24H25Cl3Si |
| Molecular Weight | 447.91 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | trichloro-[5-cyclopenta-2,4-dien-1-yl-5-(9H-fluoren-9-yl)hexyl]silane |
| SMILES | CC(CCCC[Si](Cl)(Cl)Cl)(C1C=CC=C1)C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H25Cl3Si/c1-24(18-10-2-3-11-18,16-8-9-17-28(25,26)27)23-21-14-6-4-12-19(21)20-13-5-7-15-22(20)23/h2-7,10-15,18,23H,8-9,16-17H2,1H3 |
| InChIKey | DRGSPRSOZRWLHT-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.91 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|