C33H34OSi — CID 86212953
4,4-di(cyclopenta-2,4-dien-1-yl)pentoxy-triphenylsilane (PubChem CID 86212953) has the molecular formula C33H34OSi and a molecular weight of 474.72 g/mol. Its IUPAC name is 4,4-di(cyclopenta-2,4-dien-1-yl)pentoxy-triphenylsilane.
| Compound Name | 4,4-di(cyclopenta-2,4-dien-1-yl)pentoxy-triphenylsilane |
|---|---|
| PubChem CID | 86212953 |
| Molecular Formula | C33H34OSi |
| Molecular Weight | 474.72 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | 4,4-di(cyclopenta-2,4-dien-1-yl)pentoxy-triphenylsilane |
| SMILES | CC(CCCO[Si](c1ccccc1)(c1ccccc1)c1ccccc1)(C1C=CC=C1)C1C=CC=C1 |
| InChI | InChI=1S/C33H34OSi/c1-33(28-16-11-12-17-28,29-18-13-14-19-29)26-15-27-34-35(30-20-5-2-6-21-30,31-22-7-3-8-23-31)32-24-9-4-10-25-32/h2-14,16-25,28-29H,15,26-27H2,1H3 |
| InChIKey | GLQHCFDRKVFIOE-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.72 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|