C22H21F3OSi — CID 150215925
triphenyl(4,4,4-trifluorobutoxy)silane (PubChem CID 150215925) has the molecular formula C22H21F3OSi and a molecular weight of 386.49 g/mol. Its IUPAC name is triphenyl(4,4,4-trifluorobutoxy)silane.
| Compound Name | triphenyl(4,4,4-trifluorobutoxy)silane |
|---|---|
| PubChem CID | 150215925 |
| Molecular Formula | C22H21F3OSi |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | triphenyl(4,4,4-trifluorobutoxy)silane |
| SMILES | FC(F)(F)CCCO[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H21F3OSi/c23-22(24,25)17-10-18-26-27(19-11-4-1-5-12-19,20-13-6-2-7-14-20)21-15-8-3-9-16-21/h1-9,11-16H,10,17-18H2 |
| InChIKey | FSMANKIIIKCXBX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|