C14H13F3N2OS — CID 82783382
2-(4,4,4-trifluorobutoxy)quinoline-4-carbothioamide (PubChem CID 82783382) has the molecular formula C14H13F3N2OS and a molecular weight of 314.33 g/mol. Its IUPAC name is 2-(4,4,4-trifluorobutoxy)quinoline-4-carbothioamide.
| Compound Name | 2-(4,4,4-trifluorobutoxy)quinoline-4-carbothioamide |
|---|---|
| PubChem CID | 82783382 |
| Molecular Formula | C14H13F3N2OS |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 2-(4,4,4-trifluorobutoxy)quinoline-4-carbothioamide |
| SMILES | NC(=S)c1cc(OCCCC(F)(F)F)nc2ccccc12 |
| InChI | InChI=1S/C14H13F3N2OS/c15-14(16,17)6-3-7-20-12-8-10(13(18)21)9-4-1-2-5-11(9)19-12/h1-2,4-5,8H,3,6-7H2,(H2,18,21) |
| InChIKey | CXNDQDJUXLBTLE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|