C16H21N3OS — CID 79672354
2-[2-(dimethylamino)-2-methylpropoxy]quinoline-4-carbothioamide (PubChem CID 79672354) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is 2-[2-(dimethylamino)-2-methylpropoxy]quinoline-4-carbothioamide.
| Compound Name | 2-[2-(dimethylamino)-2-methylpropoxy]quinoline-4-carbothioamide |
|---|---|
| PubChem CID | 79672354 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 2-[2-(dimethylamino)-2-methylpropoxy]quinoline-4-carbothioamide |
| SMILES | CN(C)C(C)(C)COc1cc(C(N)=S)c2ccccc2n1 |
| InChI | InChI=1S/C16H21N3OS/c1-16(2,19(3)4)10-20-14-9-12(15(17)21)11-7-5-6-8-13(11)18-14/h5-9H,10H2,1-4H3,(H2,17,21) |
| InChIKey | FQQPLZCDPDDRBE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|