C14H17N3S — CID 63885506
2-(tert-butylamino)quinoline-4-carbothioamide (PubChem CID 63885506) has the molecular formula C14H17N3S and a molecular weight of 259.38 g/mol. Its IUPAC name is 2-(tert-butylamino)quinoline-4-carbothioamide.
| Compound Name | 2-(tert-butylamino)quinoline-4-carbothioamide |
|---|---|
| PubChem CID | 63885506 |
| Molecular Formula | C14H17N3S |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 2-(tert-butylamino)quinoline-4-carbothioamide |
| SMILES | CC(C)(C)Nc1cc(C(N)=S)c2ccccc2n1 |
| InChI | InChI=1S/C14H17N3S/c1-14(2,3)17-12-8-10(13(15)18)9-6-4-5-7-11(9)16-12/h4-8H,1-3H3,(H2,15,18)(H,16,17) |
| InChIKey | DUWATGVMMWHDHK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|