C14H12N4OS — CID 106418218
2-(1,2-oxazol-5-ylmethylamino)quinoline-4-carbothioamide (PubChem CID 106418218) has the molecular formula C14H12N4OS and a molecular weight of 284.34 g/mol. Its IUPAC name is 2-(1,2-oxazol-5-ylmethylamino)quinoline-4-carbothioamide.
| Compound Name | 2-(1,2-oxazol-5-ylmethylamino)quinoline-4-carbothioamide |
|---|---|
| PubChem CID | 106418218 |
| Molecular Formula | C14H12N4OS |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 2-(1,2-oxazol-5-ylmethylamino)quinoline-4-carbothioamide |
| SMILES | NC(=S)c1cc(NCc2ccno2)nc2ccccc12 |
| InChI | InChI=1S/C14H12N4OS/c15-14(20)11-7-13(16-8-9-5-6-17-19-9)18-12-4-2-1-3-10(11)12/h1-7H,8H2,(H2,15,20)(H,16,18) |
| InChIKey | QHHGRJBDWFJUGB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|