C15H14N4S2 — CID 63886101
2-[(4-methyl-1,3-thiazol-2-yl)methylamino]quinoline-4-carbothioamide (PubChem CID 63886101) has the molecular formula C15H14N4S2 and a molecular weight of 314.44 g/mol. Its IUPAC name is 2-[(4-methyl-1,3-thiazol-2-yl)methylamino]quinoline-4-carbothioamide.
| Compound Name | 2-[(4-methyl-1,3-thiazol-2-yl)methylamino]quinoline-4-carbothioamide |
|---|---|
| PubChem CID | 63886101 |
| Molecular Formula | C15H14N4S2 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 2-[(4-methyl-1,3-thiazol-2-yl)methylamino]quinoline-4-carbothioamide |
| SMILES | Cc1csc(CNc2cc(C(N)=S)c3ccccc3n2)n1 |
| InChI | InChI=1S/C15H14N4S2/c1-9-8-21-14(18-9)7-17-13-6-11(15(16)20)10-4-2-3-5-12(10)19-13/h2-6,8H,7H2,1H3,(H2,16,20)(H,17,19) |
| InChIKey | IUXGVCCPYUBKEQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|