C11H11N3S — CID 63886082
2-(methylamino)quinoline-4-carbothioamide (PubChem CID 63886082) has the molecular formula C11H11N3S and a molecular weight of 217.30 g/mol. Its IUPAC name is 2-(methylamino)quinoline-4-carbothioamide.
| Compound Name | 2-(methylamino)quinoline-4-carbothioamide |
|---|---|
| PubChem CID | 63886082 |
| Molecular Formula | C11H11N3S |
| Molecular Weight | 217.30 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 2-(methylamino)quinoline-4-carbothioamide |
| SMILES | CNc1cc(C(N)=S)c2ccccc2n1 |
| InChI | InChI=1S/C11H11N3S/c1-13-10-6-8(11(12)15)7-4-2-3-5-9(7)14-10/h2-6H,1H3,(H2,12,15)(H,13,14) |
| InChIKey | UJHWMFGQUUYFOJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|