C12H10F3N3O — CID 63885310
2-(2,2,2-trifluoroethoxy)quinoline-4-carboximidamide (PubChem CID 63885310) has the molecular formula C12H10F3N3O and a molecular weight of 269.23 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethoxy)quinoline-4-carboximidamide.
| Compound Name | 2-(2,2,2-trifluoroethoxy)quinoline-4-carboximidamide |
|---|---|
| PubChem CID | 63885310 |
| Molecular Formula | C12H10F3N3O |
| Molecular Weight | 269.23 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 2-(2,2,2-trifluoroethoxy)quinoline-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(OCC(F)(F)F)nc2ccccc12 |
| InChI | InChI=1S/C12H10F3N3O/c13-12(14,15)6-19-10-5-8(11(16)17)7-3-1-2-4-9(7)18-10/h1-5H,6H2,(H3,16,17) |
| InChIKey | METLCTJKJZNLAE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 71.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.23 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|