C8H8F3N3O — CID 24699862
2-(2,2,2-trifluoroethoxy)pyridine-3-carboximidamide (PubChem CID 24699862) has the molecular formula C8H8F3N3O and a molecular weight of 219.17 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethoxy)pyridine-3-carboximidamide.
| Compound Name | 2-(2,2,2-trifluoroethoxy)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 24699862 |
| Molecular Formula | C8H8F3N3O |
| Molecular Weight | 219.17 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 2-(2,2,2-trifluoroethoxy)pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1cccnc1OCC(F)(F)F |
| InChI | InChI=1S/C8H8F3N3O/c9-8(10,11)4-15-7-5(6(12)13)2-1-3-14-7/h1-3H,4H2,(H3,12,13) |
| InChIKey | OXQBGHOCBCHYTM-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 71.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.17 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|